C17H10F3N3 — CID 14207820
2-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinoline (PubChem CID 14207820) has the molecular formula C17H10F3N3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinoline.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 14207820 |
| Molecular Formula | C17H10F3N3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinoline |
| SMILES | FC(F)(F)c1cccc(-c2nc3c(cnc4ccccc43)[nH]2)c1 |
| InChI | InChI=1S/C17H10F3N3/c18-17(19,20)11-5-3-4-10(8-11)16-22-14-9-21-13-7-2-1-6-12(13)15(14)23-16/h1-9H,(H,22,23) |
| InChIKey | FJIDYVNPZOVPOX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |