C14H8ClNO3 — CID 140533892
6-(3-chlorophenyl)-[1,3]dioxolo[4,5-f][1,3]benzoxazole (PubChem CID 140533892) has the molecular formula C14H8ClNO3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-[1,3]dioxolo[4,5-f][1,3]benzoxazole.
| Compound Name | 6-(3-chlorophenyl)-[1,3]dioxolo[4,5-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 140533892 |
| Molecular Formula | C14H8ClNO3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 6-(3-chlorophenyl)-[1,3]dioxolo[4,5-f][1,3]benzoxazole |
| SMILES | Clc1cccc(-c2nc3cc4c(cc3o2)OCO4)c1 |
| InChI | InChI=1S/C14H8ClNO3/c15-9-3-1-2-8(4-9)14-16-10-5-12-13(18-7-17-12)6-11(10)19-14/h1-6H,7H2 |
| InChIKey | YTJGMVHZALPOJS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |