C13H7Cl2NO3S — CID 82358054
2-(3-chlorophenyl)-1,3-benzoxazole-6-sulfonyl chloride (PubChem CID 82358054) has the molecular formula C13H7Cl2NO3S and a molecular weight of 328.18 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1,3-benzoxazole-6-sulfonyl chloride.
| Compound Name | 2-(3-chlorophenyl)-1,3-benzoxazole-6-sulfonyl chloride |
|---|---|
| PubChem CID | 82358054 |
| Molecular Formula | C13H7Cl2NO3S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 2-(3-chlorophenyl)-1,3-benzoxazole-6-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2nc(-c3cccc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C13H7Cl2NO3S/c14-9-3-1-2-8(6-9)13-16-11-5-4-10(20(15,17)18)7-12(11)19-13/h1-7H |
| InChIKey | DYSGCMACBNXBAO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |