C14H10ClNO3S — CID 82358041
2-(2-methylphenyl)-1,3-benzoxazole-6-sulfonyl chloride (PubChem CID 82358041) has the molecular formula C14H10ClNO3S and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-benzoxazole-6-sulfonyl chloride.
| Compound Name | 2-(2-methylphenyl)-1,3-benzoxazole-6-sulfonyl chloride |
|---|---|
| PubChem CID | 82358041 |
| Molecular Formula | C14H10ClNO3S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-benzoxazole-6-sulfonyl chloride |
| SMILES | Cc1ccccc1-c1nc2ccc(S(=O)(=O)Cl)cc2o1 |
| InChI | InChI=1S/C14H10ClNO3S/c1-9-4-2-3-5-11(9)14-16-12-7-6-10(20(15,17)18)8-13(12)19-14/h2-8H,1H3 |
| InChIKey | WVXBQKIWPXCSHN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |