C11H12ClNO3S — CID 82358031
2-butyl-1,3-benzoxazole-6-sulfonyl chloride (PubChem CID 82358031) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-butyl-1,3-benzoxazole-6-sulfonyl chloride.
| Compound Name | 2-butyl-1,3-benzoxazole-6-sulfonyl chloride |
|---|---|
| PubChem CID | 82358031 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-butyl-1,3-benzoxazole-6-sulfonyl chloride |
| SMILES | CCCCc1nc2ccc(S(=O)(=O)Cl)cc2o1 |
| InChI | InChI=1S/C11H12ClNO3S/c1-2-3-4-11-13-9-6-5-8(17(12,14)15)7-10(9)16-11/h5-7H,2-4H2,1H3 |
| InChIKey | MRRYUHKWWQSMCT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |