C12H7ClN2O3S — CID 82358057
2-pyridin-4-yl-1,3-benzoxazole-6-sulfonyl chloride (PubChem CID 82358057) has the molecular formula C12H7ClN2O3S and a molecular weight of 294.72 g/mol. Its IUPAC name is 2-pyridin-4-yl-1,3-benzoxazole-6-sulfonyl chloride.
| Compound Name | 2-pyridin-4-yl-1,3-benzoxazole-6-sulfonyl chloride |
|---|---|
| PubChem CID | 82358057 |
| Molecular Formula | C12H7ClN2O3S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 2-pyridin-4-yl-1,3-benzoxazole-6-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2nc(-c3ccncc3)oc2c1 |
| InChI | InChI=1S/C12H7ClN2O3S/c13-19(16,17)9-1-2-10-11(7-9)18-12(15-10)8-3-5-14-6-4-8/h1-7H |
| InChIKey | ISEWPIYESZHLSG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |