C13H6ClF3N2O — CID 66880218
5-chloro-2-pyridin-4-yl-6-(trifluoromethyl)-1,3-benzoxazole (PubChem CID 66880218) has the molecular formula C13H6ClF3N2O and a molecular weight of 298.65 g/mol. Its IUPAC name is 5-chloro-2-pyridin-4-yl-6-(trifluoromethyl)-1,3-benzoxazole.
| Compound Name | 5-chloro-2-pyridin-4-yl-6-(trifluoromethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 66880218 |
| Molecular Formula | C13H6ClF3N2O |
| Molecular Weight | 298.65 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-chloro-2-pyridin-4-yl-6-(trifluoromethyl)-1,3-benzoxazole |
| SMILES | FC(F)(F)c1cc2oc(-c3ccncc3)nc2cc1Cl |
| InChI | InChI=1S/C13H6ClF3N2O/c14-9-6-10-11(5-8(9)13(15,16)17)20-12(19-10)7-1-3-18-4-2-7/h1-6H |
| InChIKey | FQQOBPPMNFIMNO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |