C12H16N2O3S — CID 22973776
N-(2-butyl-1,3-benzoxazol-5-yl)methanesulfonamide (PubChem CID 22973776) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(2-butyl-1,3-benzoxazol-5-yl)methanesulfonamide.
| Compound Name | N-(2-butyl-1,3-benzoxazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 22973776 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(2-butyl-1,3-benzoxazol-5-yl)methanesulfonamide |
| SMILES | CCCCc1nc2cc(NS(C)(=O)=O)ccc2o1 |
| InChI | InChI=1S/C12H16N2O3S/c1-3-4-5-12-13-10-8-9(14-18(2,15)16)6-7-11(10)17-12/h6-8,14H,3-5H2,1-2H3 |
| InChIKey | VWTSQQPXYYUTIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |