C14H12N2O3S — CID 155526717
N-(2-phenyl-1,3-benzoxazol-5-yl)methanesulfonamide (PubChem CID 155526717) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(2-phenyl-1,3-benzoxazol-5-yl)methanesulfonamide.
| Compound Name | N-(2-phenyl-1,3-benzoxazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 155526717 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(2-phenyl-1,3-benzoxazol-5-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C14H12N2O3S/c1-20(17,18)16-11-7-8-13-12(9-11)15-14(19-13)10-5-3-2-4-6-10/h2-9,16H,1H3 |
| InChIKey | MEFGMEZNBFFZJC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |