C14H13N3O3S — CID 151173328
N-[2-(5-amino-1,3-benzoxazol-2-yl)phenyl]methanesulfonamide (PubChem CID 151173328) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[2-(5-amino-1,3-benzoxazol-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[2-(5-amino-1,3-benzoxazol-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 151173328 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[2-(5-amino-1,3-benzoxazol-2-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C14H13N3O3S/c1-21(18,19)17-11-5-3-2-4-10(11)14-16-12-8-9(15)6-7-13(12)20-14/h2-8,17H,15H2,1H3 |
| InChIKey | NCSZSWZZHMQZQX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|