C22H14N2O3 — CID 168516646
2-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]isoindole-1,3-dione (PubChem CID 168516646) has the molecular formula C22H14N2O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168516646 |
| Molecular Formula | C22H14N2O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]isoindole-1,3-dione |
| SMILES | Cc1ccccc1-c1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2o1 |
| InChI | InChI=1S/C22H14N2O3/c1-13-6-2-3-7-15(13)20-23-18-11-10-14(12-19(18)27-20)24-21(25)16-8-4-5-9-17(16)22(24)26/h2-12H,1H3 |
| InChIKey | MERPVBJCHOLKNZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|