C12H8N2O6 — CID 102108395
2-(1,3-benzodioxol-5-yl)-1H-imidazole-4,5-dicarboxylic acid (PubChem CID 102108395) has the molecular formula C12H8N2O6 and a molecular weight of 276.20 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1H-imidazole-4,5-dicarboxylic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1H-imidazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102108395 |
| Molecular Formula | C12H8N2O6 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1H-imidazole-4,5-dicarboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc3c(c2)OCO3)[nH]c1C(=O)O |
| InChI | InChI=1S/C12H8N2O6/c15-11(16)8-9(12(17)18)14-10(13-8)5-1-2-6-7(3-5)20-4-19-6/h1-3H,4H2,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | QUMLXJJPRSQVLQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |