5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid

C11H8N2O4S — CID 103199844

IUPAC5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid
SMILESNc1sc(-c2ccc3c(c2)OCO3)nc1C(=O)O
InChIInChI=1S/C11H8N2O4S/c12-9-8(11(14)15)13-10(18-9)5-1-2-6-7(3-5)17-4-16-6/h1-3H,4,12H2,(H,14,15)
InChIKeyWBCJGGFTRXBHJJ-UHFFFAOYSA-N
MW264.26 g/mol
LogP1.82
Rot. Bonds2

About 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid

5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 103199844) has the molecular formula C11H8N2O4S and a molecular weight of 264.26 g/mol. Its IUPAC name is 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid
PubChem CID103199844
Molecular FormulaC11H8N2O4S
Molecular Weight264.26 g/mol
Exact Mass264.02
IUPAC Name5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid
SMILESNc1sc(-c2ccc3c(c2)OCO3)nc1C(=O)O
InChIInChI=1S/C11H8N2O4S/c12-9-8(11(14)15)13-10(18-9)5-1-2-6-7(3-5)17-4-16-6/h1-3H,4,12H2,(H,14,15)
InChIKeyWBCJGGFTRXBHJJ-UHFFFAOYSA-N
XLogP1.82
TPSA94.67 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.26
LogP ≤ 51.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid (CID 103199844) is 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid is Nc1sc(-c2ccc3c(c2)OCO3)nc1C(=O)O.
What is the InChIKey of 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is WBCJGGFTRXBHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O4S/c12-9-8(11(14)15)13-10(18-9)5-1-2-6-7(3-5)17-4-16-6/h1-3H,4,12H2,(H,14,15).
What are the key properties of 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid?
5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 264.26 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 103199844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).