5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid

C10H6Br2N2O2S — CID 107981281

IUPAC5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid
SMILESNc1sc(-c2cc(Br)cc(Br)c2)nc1C(=O)O
InChIInChI=1S/C10H6Br2N2O2S/c11-5-1-4(2-6(12)3-5)9-14-7(10(15)16)8(13)17-9/h1-3H,13H2,(H,15,16)
InChIKeyGGHXYRKPAKDAMV-UHFFFAOYSA-N
MW378.05 g/mol
LogP3.62
Rot. Bonds2

About 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid

5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 107981281) has the molecular formula C10H6Br2N2O2S and a molecular weight of 378.05 g/mol. Its IUPAC name is 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid
PubChem CID107981281
Molecular FormulaC10H6Br2N2O2S
Molecular Weight378.05 g/mol
Exact Mass375.85
IUPAC Name5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid
SMILESNc1sc(-c2cc(Br)cc(Br)c2)nc1C(=O)O
InChIInChI=1S/C10H6Br2N2O2S/c11-5-1-4(2-6(12)3-5)9-14-7(10(15)16)8(13)17-9/h1-3H,13H2,(H,15,16)
InChIKeyGGHXYRKPAKDAMV-UHFFFAOYSA-N
XLogP3.62
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500378.05
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid (CID 107981281) is 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid is Nc1sc(-c2cc(Br)cc(Br)c2)nc1C(=O)O.
What is the InChIKey of 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is GGHXYRKPAKDAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Br2N2O2S/c11-5-1-4(2-6(12)3-5)9-14-7(10(15)16)8(13)17-9/h1-3H,13H2,(H,15,16).
What are the key properties of 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid?
5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 378.05 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(3,5-dibromophenyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 107981281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).