C22H17N3O2 — CID 142047620
(2R)-5-(1,3-benzodioxol-5-yl)-9-phenyl-8,10-diazatricyclo[5.4.0.02,11]undeca-3,5,7,9-tetraen-3-amine (PubChem CID 142047620) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is (2R)-5-(1,3-benzodioxol-5-yl)-9-phenyl-8,10-diazatricyclo[5.4.0.02,11]undeca-3,5,7,9-tetraen-3-amine.
| Compound Name | (2R)-5-(1,3-benzodioxol-5-yl)-9-phenyl-8,10-diazatricyclo[5.4.0.02,11]undeca-3,5,7,9-tetraen-3-amine |
|---|---|
| PubChem CID | 142047620 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2R)-5-(1,3-benzodioxol-5-yl)-9-phenyl-8,10-diazatricyclo[5.4.0.02,11]undeca-3,5,7,9-tetraen-3-amine |
| SMILES | NC1=CC(c2ccc3c(c2)OCO3)=CC2=NC(c3ccccc3)=NC3C2[C@@H]13 |
| InChI | InChI=1S/C22H17N3O2/c23-15-8-14(13-6-7-17-18(10-13)27-11-26-17)9-16-20-19(15)21(20)25-22(24-16)12-4-2-1-3-5-12/h1-10,19-21H,11,23H2/t19-,20?,21?/m1/s1 |
| InChIKey | XOGYAXOMICIUCI-QNGMFEMESA-N |
| XLogP | 3.17 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |