C18H12N2O4S — CID 25067968
5-[[4-(1,3-benzodioxol-5-yl)phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 25067968) has the molecular formula C18H12N2O4S and a molecular weight of 352.37 g/mol. Its IUPAC name is 5-[[4-(1,3-benzodioxol-5-yl)phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-(1,3-benzodioxol-5-yl)phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 25067968 |
| Molecular Formula | C18H12N2O4S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 5-[[4-(1,3-benzodioxol-5-yl)phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H12N2O4S/c21-16-13(17(22)20-18(25)19-16)7-10-1-3-11(4-2-10)12-5-6-14-15(8-12)24-9-23-14/h1-8H,9H2,(H2,19,20,21,22,25) |
| InChIKey | XOBYZMRYGQLZMH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|