C11H7NO3S3 — CID 142671335
5-(1,3-benzodioxol-5-ylmethylidene)-1,2-bis(sulfanylidene)-1,3-thiazolidin-4-one (PubChem CID 142671335) has the molecular formula C11H7NO3S3 and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-1,2-bis(sulfanylidene)-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1,2-bis(sulfanylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142671335 |
| Molecular Formula | C11H7NO3S3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1,2-bis(sulfanylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S(=S)C1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H7NO3S3/c13-10-9(18(17)11(16)12-10)4-6-1-2-7-8(3-6)15-5-14-7/h1-4H,5H2,(H,12,13,16) |
| InChIKey | RKXARGLUAFFMRR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|