C13H12N2O3S — CID 839150
5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 839150) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 839150 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)C(=Cc2ccc3c(c2)OCO3)N(C)C1=S |
| InChI | InChI=1S/C13H12N2O3S/c1-14-9(12(16)15(2)13(14)19)5-8-3-4-10-11(6-8)18-7-17-10/h3-6H,7H2,1-2H3 |
| InChIKey | RFXCLDGFYWRBQW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|