C28H26N4O11 — CID 159163808
1,3-benzodioxole-5-carbaldehyde;5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione;1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 159163808) has the molecular formula C28H26N4O11 and a molecular weight of 594.53 g/mol. Its IUPAC name is 1,3-benzodioxole-5-carbaldehyde;5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione;1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-benzodioxole-5-carbaldehyde;5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione;1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 159163808 |
| Molecular Formula | C28H26N4O11 |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 1,3-benzodioxole-5-carbaldehyde;5-(1,3-benzodioxol-5-ylmethylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione;1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2ccc3c(c2)OCO3)C(=O)N(C)C1=O.CN1C(=O)CC(=O)N(C)C1=O.O=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N2O5.C8H6O3.C6H8N2O3/c1-15-12(17)9(13(18)16(2)14(15)19)5-8-3-4-10-11(6-8)21-7-20-10;9-4-6-1-2-7-8(3-6)11-5-10-7;1-7-4(9)3-5(10)8(2)6(7)11/h3-6H,7H2,1-2H3;1-4H,5H2;3H2,1-2H3 |
| InChIKey | KKUYYXLRMXUSES-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 169.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|