C12H11N3O3 — CID 162938933
5-(1,3-benzodioxol-5-ylmethylidene)-2-imino-1-methylimidazolidin-4-one (PubChem CID 162938933) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-2-imino-1-methylimidazolidin-4-one.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-2-imino-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 162938933 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-2-imino-1-methylimidazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccc3c(c2)OCO3)N1C |
| InChI | InChI=1S/C12H11N3O3/c1-15-8(11(16)14-12(15)13)4-7-2-3-9-10(5-7)18-6-17-9/h2-5H,6H2,1H3,(H2,13,14,16) |
| InChIKey | PWMMZSKORREWPB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|