C24H26N6O6 — CID 157483487
5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one (PubChem CID 157483487) has the molecular formula C24H26N6O6 and a molecular weight of 494.51 g/mol. Its IUPAC name is 5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one.
| Compound Name | 5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 157483487 |
| Molecular Formula | C24H26N6O6 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2ccc(OC)c(O)c2)N1C.[H]/N=C1\NC(=O)C(=Cc2ccc(OC)c(O)c2)N1C |
| InChI | InChI=1S/2C12H13N3O3/c2*1-15-8(11(17)14-12(15)13)5-7-3-4-10(18-2)9(16)6-7/h2*3-6,16H,1-2H3,(H2,13,14,17) |
| InChIKey | BWKUVYZFNQGFEK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 171.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|