C13H15N3O4 — CID 140632500
5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one (PubChem CID 140632500) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one.
| Compound Name | 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 140632500 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-imino-1-methylimidazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2cc(OC)c(O)c(OC)c2)N1C |
| InChI | InChI=1S/C13H15N3O4/c1-16-8(12(18)15-13(16)14)4-7-5-9(19-2)11(17)10(6-7)20-3/h4-6,17H,1-3H3,(H2,14,15,18) |
| InChIKey | CFQQCFVBAVPGGM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|