C15H17N3O4 — CID 154778527
ethyl 2-[2-[(Z)-(2-imino-3-methyl-5-oxoimidazolidin-4-ylidene)methyl]phenoxy]acetate (PubChem CID 154778527) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-(2-imino-3-methyl-5-oxoimidazolidin-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(Z)-(2-imino-3-methyl-5-oxoimidazolidin-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 154778527 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | ethyl 2-[2-[(Z)-(2-imino-3-methyl-5-oxoimidazolidin-4-ylidene)methyl]phenoxy]acetate |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2ccccc2OCC(=O)OCC)N1C |
| InChI | InChI=1S/C15H17N3O4/c1-3-21-13(19)9-22-12-7-5-4-6-10(12)8-11-14(20)17-15(16)18(11)2/h4-8H,3,9H2,1-2H3,(H2,16,17,20)/b11-8- |
| InChIKey | MUXISBVMDMGSAY-FLIBITNWSA-N |
| XLogP | 0.97 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|