C14H17N3O4 — CID 171128296
2-imino-1-methyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one (PubChem CID 171128296) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-imino-1-methyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one.
| Compound Name | 2-imino-1-methyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 171128296 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-imino-1-methyl-5-[(2,4,5-trimethoxyphenyl)methylidene]imidazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2cc(OC)c(OC)cc2OC)N1C |
| InChI | InChI=1S/C14H17N3O4/c1-17-9(13(18)16-14(17)15)5-8-6-11(20-3)12(21-4)7-10(8)19-2/h5-7H,1-4H3,(H2,15,16,18) |
| InChIKey | HZXMZMDTBYMQOF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|