C21H20N2O7 — CID 1353274
1-(2-methoxyphenyl)-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1353274) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-methoxyphenyl)-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1353274 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-(2-methoxyphenyl)-5-[(2,4,5-trimethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(OC)c(OC)cc1C=C1C(=O)NC(=O)N(c2ccccc2OC)C1=O |
| InChI | InChI=1S/C21H20N2O7/c1-27-15-8-6-5-7-14(15)23-20(25)13(19(24)22-21(23)26)9-12-10-17(29-3)18(30-4)11-16(12)28-2/h5-11H,1-4H3,(H,22,24,26) |
| InChIKey | YWQKZJSINSQMLH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|