C14H15N3O3 — CID 135907689
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-ethylimino-3-methylimidazolidin-4-one (PubChem CID 135907689) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-ethylimino-3-methylimidazolidin-4-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-ethylimino-3-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 135907689 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-ethylimino-3-methylimidazolidin-4-one |
| SMILES | CC/N=C1/N/C(=C/c2ccc3c(c2)OCO3)C(=O)N1C |
| InChI | InChI=1S/C14H15N3O3/c1-3-15-14-16-10(13(18)17(14)2)6-9-4-5-11-12(7-9)20-8-19-11/h4-7H,3,8H2,1-2H3,(H,15,16)/b10-6+ |
| InChIKey | OQZNCAIFCVGTSZ-UXBLZVDNSA-N |
| XLogP | 1.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|