C21H21N5O5 — CID 135860198
(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-methyl-2-[2-[(4-nitrophenyl)methylamino]ethylimino]imidazolidin-4-one (PubChem CID 135860198) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-methyl-2-[2-[(4-nitrophenyl)methylamino]ethylimino]imidazolidin-4-one.
| Compound Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-methyl-2-[2-[(4-nitrophenyl)methylamino]ethylimino]imidazolidin-4-one |
|---|---|
| PubChem CID | 135860198 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-3-methyl-2-[2-[(4-nitrophenyl)methylamino]ethylimino]imidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/c2ccc3c(c2)OCO3)N/C1=N/CCNCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N5O5/c1-25-20(27)17(10-15-4-7-18-19(11-15)31-13-30-18)24-21(25)23-9-8-22-12-14-2-5-16(6-3-14)26(28)29/h2-7,10-11,22H,8-9,12-13H2,1H3,(H,23,24)/b17-10- |
| InChIKey | KABCWHGVLPUOKP-YVLHZVERSA-N |
| XLogP | 1.87 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|