C22H21N3O5S — CID 25183925
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-3-butyl-2-[(4-nitrophenyl)methylsulfanyl]imidazol-4-one (PubChem CID 25183925) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-3-butyl-2-[(4-nitrophenyl)methylsulfanyl]imidazol-4-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-3-butyl-2-[(4-nitrophenyl)methylsulfanyl]imidazol-4-one |
|---|---|
| PubChem CID | 25183925 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-3-butyl-2-[(4-nitrophenyl)methylsulfanyl]imidazol-4-one |
| SMILES | CCCCN1C(=O)/C(=C\c2ccc3c(c2)OCO3)N=C1SCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21N3O5S/c1-2-3-10-24-21(26)18(11-16-6-9-19-20(12-16)30-14-29-19)23-22(24)31-13-15-4-7-17(8-5-15)25(27)28/h4-9,11-12H,2-3,10,13-14H2,1H3/b18-11+ |
| InChIKey | NOZOHBDBRGVEJW-WOJGMQOQSA-N |
| XLogP | 4.60 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|