C14H13ClN2O3S — CID 25183891
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chloroethylsulfanyl)-3-methylimidazol-4-one (PubChem CID 25183891) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chloroethylsulfanyl)-3-methylimidazol-4-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chloroethylsulfanyl)-3-methylimidazol-4-one |
|---|---|
| PubChem CID | 25183891 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(2-chloroethylsulfanyl)-3-methylimidazol-4-one |
| SMILES | CN1C(=O)/C(=C\c2ccc3c(c2)OCO3)N=C1SCCCl |
| InChI | InChI=1S/C14H13ClN2O3S/c1-17-13(18)10(16-14(17)21-5-4-15)6-9-2-3-11-12(7-9)20-8-19-11/h2-3,6-7H,4-5,8H2,1H3/b10-6+ |
| InChIKey | VSCBEVIJMHOOSE-UXBLZVDNSA-N |
| XLogP | 2.56 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|