C28H23FN2O4S — CID 16504259
(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(4-methylphenyl)imidazol-4-one (PubChem CID 16504259) has the molecular formula C28H23FN2O4S and a molecular weight of 502.57 g/mol. Its IUPAC name is (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(4-methylphenyl)imidazol-4-one.
| Compound Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(4-methylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 16504259 |
| Molecular Formula | C28H23FN2O4S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(4-methylphenyl)imidazol-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc4c(c3)OCO4)N=C2SCCCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H23FN2O4S/c1-18-4-11-22(12-5-18)31-27(33)23(15-19-6-13-25-26(16-19)35-17-34-25)30-28(31)36-14-2-3-24(32)20-7-9-21(29)10-8-20/h4-13,15-16H,2-3,14,17H2,1H3/b23-15+ |
| InChIKey | SAXBJHOBABCEBB-HZHRSRAPSA-N |
| XLogP | 6.00 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|