C20H19N3O6 — CID 86804914
5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-[2-(4-nitrophenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 86804914) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-[2-(4-nitrophenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-[2-(4-nitrophenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 86804914 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-5-methyl-3-[2-(4-nitrophenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(Cc2ccc3c(c2)OCO3)NC(=O)N(CCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C20H19N3O6/c1-20(11-14-4-7-16-17(10-14)29-12-28-16)18(24)22(19(25)21-20)9-8-13-2-5-15(6-3-13)23(26)27/h2-7,10H,8-9,11-12H2,1H3,(H,21,25) |
| InChIKey | DUTWVELJLMFZNQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|