C15H17N3O5 — CID 31577649
3-[(4R)-4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide (PubChem CID 31577649) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-[(4R)-4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide.
| Compound Name | 3-[(4R)-4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 31577649 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[(4R)-4-(1,3-benzodioxol-5-ylmethyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide |
| SMILES | C[C@]1(Cc2ccc3c(c2)OCO3)NC(=O)N(CCC(N)=O)C1=O |
| InChI | InChI=1S/C15H17N3O5/c1-15(7-9-2-3-10-11(6-9)23-8-22-10)13(20)18(14(21)17-15)5-4-12(16)19/h2-3,6H,4-5,7-8H2,1H3,(H2,16,19)(H,17,21)/t15-/m1/s1 |
| InChIKey | AATUHJRCOWGPID-OAHLLOKOSA-N |
| XLogP | 0.14 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|