C14H13N3O4 — CID 6054669
N-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-4-oxoimidazol-2-yl]acetamide (PubChem CID 6054669) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is N-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-4-oxoimidazol-2-yl]acetamide.
| Compound Name | N-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-4-oxoimidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6054669 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-1-methyl-4-oxoimidazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)/C(=C\c2ccc3c(c2)OCO3)N1C |
| InChI | InChI=1S/C14H13N3O4/c1-8(18)15-14-16-13(19)10(17(14)2)5-9-3-4-11-12(6-9)21-7-20-11/h3-6H,7H2,1-2H3,(H,15,16,18,19)/b10-5+ |
| InChIKey | TWZXXCLGIQVRIT-BJMVGYQFSA-N |
| XLogP | 0.72 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|