C16H14N2O6 — CID 155807582
5-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 155807582) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is 5-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 155807582 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 5-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(C(=O)/C=C/c2ccc3c(c2)OCO3)C(=O)N(C)C1=O |
| InChI | InChI=1S/C16H14N2O6/c1-17-14(20)13(15(21)18(2)16(17)22)10(19)5-3-9-4-6-11-12(7-9)24-8-23-11/h3-7,13H,8H2,1-2H3/b5-3+ |
| InChIKey | FHELULSSDQKZNR-HWKANZROSA-N |
| XLogP | 0.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|