C12H9NO3S2 — CID 174608118
(5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidine-2-carbothialdehyde (PubChem CID 174608118) has the molecular formula C12H9NO3S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidine-2-carbothialdehyde.
| Compound Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidine-2-carbothialdehyde |
|---|---|
| PubChem CID | 174608118 |
| Molecular Formula | C12H9NO3S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | (5Z)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-1,3-thiazolidine-2-carbothialdehyde |
| SMILES | O=C1NC(C=S)S/C1=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H9NO3S2/c14-12-10(18-11(5-17)13-12)4-7-1-2-8-9(3-7)16-6-15-8/h1-5,11H,6H2,(H,13,14)/b10-4- |
| InChIKey | WGZOBXQSCYNRDR-WMZJFQQLSA-N |
| XLogP | 1.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|