C11H11NO2S — CID 66703897
5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine (PubChem CID 66703897) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine |
|---|---|
| PubChem CID | 66703897 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine |
| SMILES | C(=C1CNCS1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11NO2S/c1-2-10-11(14-7-13-10)4-8(1)3-9-5-12-6-15-9/h1-4,12H,5-7H2 |
| InChIKey | WCLJTAXLTPQMRC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |