C13H10O3S — CID 6300693
(3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-methylthiophen-2-one (PubChem CID 6300693) has the molecular formula C13H10O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-methylthiophen-2-one.
| Compound Name | (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-methylthiophen-2-one |
|---|---|
| PubChem CID | 6300693 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-methylthiophen-2-one |
| SMILES | CC1=C/C(=C/c2ccc3c(c2)OCO3)C(=O)S1 |
| InChI | InChI=1S/C13H10O3S/c1-8-4-10(13(14)17-8)5-9-2-3-11-12(6-9)16-7-15-11/h2-6H,7H2,1H3/b10-5- |
| InChIKey | ZJCDVVPVKYCBGQ-YHYXMXQVSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|