C20H16O4 — CID 5455822
(3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-(3,4-dimethylphenyl)furan-2-one (PubChem CID 5455822) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-(3,4-dimethylphenyl)furan-2-one.
| Compound Name | (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-(3,4-dimethylphenyl)furan-2-one |
|---|---|
| PubChem CID | 5455822 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-5-(3,4-dimethylphenyl)furan-2-one |
| SMILES | Cc1ccc(C2=C/C(=C/c3ccc4c(c3)OCO4)C(=O)O2)cc1C |
| InChI | InChI=1S/C20H16O4/c1-12-3-5-15(7-13(12)2)18-10-16(20(21)24-18)8-14-4-6-17-19(9-14)23-11-22-17/h3-10H,11H2,1-2H3/b16-8- |
| InChIKey | IODFFTRDKAVKRZ-PXNMLYILSA-N |
| XLogP | 4.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|