About 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one
4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one (PubChem CID 44545014) has the molecular formula C20H17NO5
and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one |
| PubChem CID | 44545014 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one |
| SMILES | COc1ccc(-c2cc(-c3ccc4c(c3)OCO4)cc(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C20H17NO5/c1-23-16-5-4-13(9-18(16)24-2)15-7-14(10-20(22)21-15)12-3-6-17-19(8-12)26-11-25-17/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | NUFPYHNPXRWMDH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one (CID 44545014) is 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one is COc1ccc(-c2cc(-c3ccc4c(c3)OCO4)cc(=O)[nH]2)cc1OC.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one?
The InChIKey is NUFPYHNPXRWMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO5/c1-23-16-5-4-13(9-18(16)24-2)15-7-14(10-20(22)21-15)12-3-6-17-19(8-12)26-11-25-17/h3-10H,11H2,1-2H3,(H,21,22).
What are the key properties of 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one?
4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one has a molecular weight of 351.36 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-1H-pyridin-2-one is sourced from PubChem (CID 44545014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).