C17H19NO2 — CID 81289628
4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-ethylaniline (PubChem CID 81289628) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-ethylaniline.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-ethylaniline |
|---|---|
| PubChem CID | 81289628 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-ethylaniline |
| SMILES | CCc1cc(-c2ccc3c(c2)OCCCO3)ccc1N |
| InChI | InChI=1S/C17H19NO2/c1-2-12-10-13(4-6-15(12)18)14-5-7-16-17(11-14)20-9-3-8-19-16/h4-7,10-11H,2-3,8-9,18H2,1H3 |
| InChIKey | MSWAGYYJDWOGCG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|