C18H21NO2 — CID 105101240
1-(2,3-dihydro-1-benzofuran-5-yl)-5-pyridin-3-ylpentan-3-ol (PubChem CID 105101240) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-5-pyridin-3-ylpentan-3-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-5-pyridin-3-ylpentan-3-ol |
|---|---|
| PubChem CID | 105101240 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-5-pyridin-3-ylpentan-3-ol |
| SMILES | OC(CCc1cccnc1)CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H21NO2/c20-17(7-4-15-2-1-10-19-13-15)6-3-14-5-8-18-16(12-14)9-11-21-18/h1-2,5,8,10,12-13,17,20H,3-4,6-7,9,11H2 |
| InChIKey | UMVBRWUFHWLUBT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |