C18H19BrO2 — CID 65447392
1-(3-bromophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ol (PubChem CID 65447392) has the molecular formula C18H19BrO2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ol.
| Compound Name | 1-(3-bromophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 65447392 |
| Molecular Formula | C18H19BrO2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-(3-bromophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-ol |
| SMILES | OC(CCc1ccc2c(c1)CCO2)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H19BrO2/c19-16-3-1-2-14(11-16)12-17(20)6-4-13-5-7-18-15(10-13)8-9-21-18/h1-3,5,7,10-11,17,20H,4,6,8-9,12H2 |
| InChIKey | AYYCJLJVCCRYSD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |