C22H22FN3O7S — CID 66974660
but-2-enedioic acid;1-[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine (PubChem CID 66974660) has the molecular formula C22H22FN3O7S and a molecular weight of 491.50 g/mol. Its IUPAC name is but-2-enedioic acid;1-[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine.
| Compound Name | but-2-enedioic acid;1-[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66974660 |
| Molecular Formula | C22H22FN3O7S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | but-2-enedioic acid;1-[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(-c2c(F)cccc2OC)n(S(=O)(=O)c2cccnc2)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H18FN3O3S.C4H4O4/c1-20-10-13-9-16(18-15(19)6-3-7-17(18)25-2)22(12-13)26(23,24)14-5-4-8-21-11-14;5-3(6)1-2-4(7)8/h3-9,11-12,20H,10H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | BGHAZUQQJVMYBW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|