C22H20FN3O7S — CID 66974656
(E)-4-[[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid (PubChem CID 66974656) has the molecular formula C22H20FN3O7S and a molecular weight of 489.48 g/mol. Its IUPAC name is (E)-4-[[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 66974656 |
| Molecular Formula | C22H20FN3O7S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (E)-4-[[5-(2-fluoro-6-methoxyphenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
| SMILES | CNC(OC(=O)/C=C/C(=O)O)c1cc(-c2c(F)cccc2OC)n(S(=O)(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C22H20FN3O7S/c1-24-22(33-20(29)9-8-19(27)28)14-11-17(21-16(23)6-3-7-18(21)32-2)26(13-14)34(30,31)15-5-4-10-25-12-15/h3-13,22,24H,1-2H3,(H,27,28)/b9-8+ |
| InChIKey | ZSHWWJJWHVAAOY-CMDGGOBGSA-N |
| XLogP | 2.34 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|