C20H16F2N4O6S — CID 68752214
(E)-4-[[1-(2,3-difluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid (PubChem CID 68752214) has the molecular formula C20H16F2N4O6S and a molecular weight of 478.43 g/mol. Its IUPAC name is (E)-4-[[1-(2,3-difluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[1-(2,3-difluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68752214 |
| Molecular Formula | C20H16F2N4O6S |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | (E)-4-[[1-(2,3-difluorophenyl)-5-pyridin-3-ylsulfonylpyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
| SMILES | CNC(OC(=O)/C=C/C(=O)O)c1cc(S(=O)(=O)c2cccnc2)n(-c2cccc(F)c2F)n1 |
| InChI | InChI=1S/C20H16F2N4O6S/c1-23-20(32-18(29)8-7-17(27)28)14-10-16(33(30,31)12-4-3-9-24-11-12)26(25-14)15-6-2-5-13(21)19(15)22/h2-11,20,23H,1H3,(H,27,28)/b8-7+ |
| InChIKey | BFXXZHFRNLLHEA-BQYQJAHWSA-N |
| XLogP | 1.78 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|