C21H19FN4O6S — CID 68922951
(E)-4-[[1-(2-fluorophenyl)-5-[(6-methyl-3-pyridinyl)sulfonyl]pyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid (PubChem CID 68922951) has the molecular formula C21H19FN4O6S and a molecular weight of 474.47 g/mol. Its IUPAC name is (E)-4-[[1-(2-fluorophenyl)-5-[(6-methyl-3-pyridinyl)sulfonyl]pyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[1-(2-fluorophenyl)-5-[(6-methyl-3-pyridinyl)sulfonyl]pyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68922951 |
| Molecular Formula | C21H19FN4O6S |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | (E)-4-[[1-(2-fluorophenyl)-5-[(6-methyl-3-pyridinyl)sulfonyl]pyrazol-3-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
| SMILES | CNC(OC(=O)/C=C/C(=O)O)c1cc(S(=O)(=O)c2ccc(C)nc2)n(-c2ccccc2F)n1 |
| InChI | InChI=1S/C21H19FN4O6S/c1-13-7-8-14(12-24-13)33(30,31)18-11-16(21(23-2)32-20(29)10-9-19(27)28)25-26(18)17-6-4-3-5-15(17)22/h3-12,21,23H,1-2H3,(H,27,28)/b10-9+ |
| InChIKey | LGMHHMWIIDUGBE-MDZDMXLPSA-N |
| XLogP | 1.95 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|