C23H20FNO7S2 — CID 68925187
(E)-4-[[4-(2-fluorophenyl)-5-(3-methoxyphenyl)sulfonylthiophen-2-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid (PubChem CID 68925187) has the molecular formula C23H20FNO7S2 and a molecular weight of 505.55 g/mol. Its IUPAC name is (E)-4-[[4-(2-fluorophenyl)-5-(3-methoxyphenyl)sulfonylthiophen-2-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[4-(2-fluorophenyl)-5-(3-methoxyphenyl)sulfonylthiophen-2-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68925187 |
| Molecular Formula | C23H20FNO7S2 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | (E)-4-[[4-(2-fluorophenyl)-5-(3-methoxyphenyl)sulfonylthiophen-2-yl]-(methylamino)methoxy]-4-oxobut-2-enoic acid |
| SMILES | CNC(OC(=O)/C=C/C(=O)O)c1cc(-c2ccccc2F)c(S(=O)(=O)c2cccc(OC)c2)s1 |
| InChI | InChI=1S/C23H20FNO7S2/c1-25-22(32-21(28)11-10-20(26)27)19-13-17(16-8-3-4-9-18(16)24)23(33-19)34(29,30)15-7-5-6-14(12-15)31-2/h3-13,22,25H,1-2H3,(H,26,27)/b11-10+ |
| InChIKey | AXHLILGRNFJXLA-ZHACJKMWSA-N |
| XLogP | 3.80 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|