C21H17FO5S — CID 59803433
2-[3-[3-(2-fluorophenyl)phenyl]sulfonyl-5-methoxyphenyl]acetic acid (PubChem CID 59803433) has the molecular formula C21H17FO5S and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[3-[3-(2-fluorophenyl)phenyl]sulfonyl-5-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[3-(2-fluorophenyl)phenyl]sulfonyl-5-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 59803433 |
| Molecular Formula | C21H17FO5S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-[3-[3-(2-fluorophenyl)phenyl]sulfonyl-5-methoxyphenyl]acetic acid |
| SMILES | COc1cc(CC(=O)O)cc(S(=O)(=O)c2cccc(-c3ccccc3F)c2)c1 |
| InChI | InChI=1S/C21H17FO5S/c1-27-16-9-14(11-21(23)24)10-18(13-16)28(25,26)17-6-4-5-15(12-17)19-7-2-3-8-20(19)22/h2-10,12-13H,11H2,1H3,(H,23,24) |
| InChIKey | UYFYQAQVVQUYGP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |