C23H19F3O6S — CID 141170423
2-[3-ethoxy-5-[2-phenyl-6-(trifluoromethoxy)phenyl]sulfonylphenyl]acetic acid (PubChem CID 141170423) has the molecular formula C23H19F3O6S and a molecular weight of 480.46 g/mol. Its IUPAC name is 2-[3-ethoxy-5-[2-phenyl-6-(trifluoromethoxy)phenyl]sulfonylphenyl]acetic acid.
| Compound Name | 2-[3-ethoxy-5-[2-phenyl-6-(trifluoromethoxy)phenyl]sulfonylphenyl]acetic acid |
|---|---|
| PubChem CID | 141170423 |
| Molecular Formula | C23H19F3O6S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-[3-ethoxy-5-[2-phenyl-6-(trifluoromethoxy)phenyl]sulfonylphenyl]acetic acid |
| SMILES | CCOc1cc(CC(=O)O)cc(S(=O)(=O)c2c(OC(F)(F)F)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H19F3O6S/c1-2-31-17-11-15(13-21(27)28)12-18(14-17)33(29,30)22-19(16-7-4-3-5-8-16)9-6-10-20(22)32-23(24,25)26/h3-12,14H,2,13H2,1H3,(H,27,28) |
| InChIKey | MKONNWZUASSYAF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |