C22H21NO6S — CID 59820503
2-[3-ethoxy-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]sulfonylphenyl]acetic acid (PubChem CID 59820503) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-[3-ethoxy-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]sulfonylphenyl]acetic acid.
| Compound Name | 2-[3-ethoxy-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]sulfonylphenyl]acetic acid |
|---|---|
| PubChem CID | 59820503 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[3-ethoxy-5-[4-[(6-methyl-2-pyridinyl)oxy]phenyl]sulfonylphenyl]acetic acid |
| SMILES | CCOc1cc(CC(=O)O)cc(S(=O)(=O)c2ccc(Oc3cccc(C)n3)cc2)c1 |
| InChI | InChI=1S/C22H21NO6S/c1-3-28-18-11-16(13-22(24)25)12-20(14-18)30(26,27)19-9-7-17(8-10-19)29-21-6-4-5-15(2)23-21/h4-12,14H,3,13H2,1-2H3,(H,24,25) |
| InChIKey | ZZIANNHHAKJIAU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |